C10H11ClF3N5O — CID 107490741
7-[2-chloroethyl(2,2,2-trifluoroethyl)amino]-5-methyl-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one (PubChem CID 107490741) has the molecular formula C10H11ClF3N5O and a molecular weight of 309.68 g/mol. Its IUPAC name is 7-[2-chloroethyl(2,2,2-trifluoroethyl)amino]-5-methyl-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one.
| Compound Name | 7-[2-chloroethyl(2,2,2-trifluoroethyl)amino]-5-methyl-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
|---|---|
| PubChem CID | 107490741 |
| Molecular Formula | C10H11ClF3N5O |
| Molecular Weight | 309.68 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 7-[2-chloroethyl(2,2,2-trifluoroethyl)amino]-5-methyl-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
| SMILES | Cc1nc(N(CCCl)CC(F)(F)F)cc2n[nH]c(=O)n12 |
| InChI | InChI=1S/C10H11ClF3N5O/c1-6-15-7(4-8-16-17-9(20)19(6)8)18(3-2-11)5-10(12,13)14/h4H,2-3,5H2,1H3,(H,17,20) |
| InChIKey | JOFYTKRYLAKVBH-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.68 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|