C12H22ClF2NO — CID 107490939
N-(2-chloroethyl)-N-(2,2-difluoroethyl)octanamide (PubChem CID 107490939) has the molecular formula C12H22ClF2NO and a molecular weight of 269.76 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-(2,2-difluoroethyl)octanamide.
| Compound Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)octanamide |
|---|---|
| PubChem CID | 107490939 |
| Molecular Formula | C12H22ClF2NO |
| Molecular Weight | 269.76 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)octanamide |
| SMILES | CCCCCCCC(=O)N(CCCl)CC(F)F |
| InChI | InChI=1S/C12H22ClF2NO/c1-2-3-4-5-6-7-12(17)16(9-8-13)10-11(14)15/h11H,2-10H2,1H3 |
| InChIKey | UEBSHZAWBQKFQQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.76 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|