C12H20BrF2NO2 — CID 107491598
N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2,4,5-trimethyloxolane-3-carboxamide (PubChem CID 107491598) has the molecular formula C12H20BrF2NO2 and a molecular weight of 328.20 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2,4,5-trimethyloxolane-3-carboxamide.
| Compound Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2,4,5-trimethyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 107491598 |
| Molecular Formula | C12H20BrF2NO2 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2,4,5-trimethyloxolane-3-carboxamide |
| SMILES | CC1OC(C)C(C(=O)N(CCBr)CC(F)F)C1C |
| InChI | InChI=1S/C12H20BrF2NO2/c1-7-8(2)18-9(3)11(7)12(17)16(5-4-13)6-10(14)15/h7-11H,4-6H2,1-3H3 |
| InChIKey | DYZBRUAHHPZEQI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|