C9H10 — CID 10749163
(3Z)-7-methylocta-3,5,6-trien-1-yne (PubChem CID 10749163) has the molecular formula C9H10 and a molecular weight of 118.18 g/mol. Its IUPAC name is (3Z)-7-methylocta-3,5,6-trien-1-yne.
| Compound Name | (3Z)-7-methylocta-3,5,6-trien-1-yne |
|---|---|
| PubChem CID | 10749163 |
| Molecular Formula | C9H10 |
| Molecular Weight | 118.18 g/mol |
| Exact Mass | 118.08 |
| IUPAC Name | (3Z)-7-methylocta-3,5,6-trien-1-yne |
| SMILES | C#C/C=C\C=C=C(C)C |
| InChI | InChI=1S/C9H10/c1-4-5-6-7-8-9(2)3/h1,5-7H,2-3H3/b6-5- |
| InChIKey | RTFMKHNBHVGQSN-WAYWQWQTSA-N |
| XLogP | 2.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.18 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|