About N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3,6-dimethylpyridazine-4-carboxamide
N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3,6-dimethylpyridazine-4-carboxamide (PubChem CID 107491674) has the molecular formula C11H14BrF2N3O
and a molecular weight of 322.15 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3,6-dimethylpyridazine-4-carboxamide.
Molecular Properties
| Compound Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3,6-dimethylpyridazine-4-carboxamide |
| PubChem CID | 107491674 |
| Molecular Formula | C11H14BrF2N3O |
| Molecular Weight | 322.15 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3,6-dimethylpyridazine-4-carboxamide |
| SMILES | Cc1cc(C(=O)N(CCBr)CC(F)F)c(C)nn1 |
| InChI | InChI=1S/C11H14BrF2N3O/c1-7-5-9(8(2)16-15-7)11(18)17(4-3-12)6-10(13)14/h5,10H,3-4,6H2,1-2H3 |
| InChIKey | POIPHZNQLHLVMC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.15 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3,6-dimethylpyridazine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3,6-dimethylpyridazine-4-carboxamide?
The IUPAC name of N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3,6-dimethylpyridazine-4-carboxamide (CID 107491674) is N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3,6-dimethylpyridazine-4-carboxamide.
What is the SMILES notation for N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3,6-dimethylpyridazine-4-carboxamide?
The canonical SMILES for N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3,6-dimethylpyridazine-4-carboxamide is Cc1cc(C(=O)N(CCBr)CC(F)F)c(C)nn1.
What is the InChIKey of N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3,6-dimethylpyridazine-4-carboxamide?
The InChIKey is POIPHZNQLHLVMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14BrF2N3O/c1-7-5-9(8(2)16-15-7)11(18)17(4-3-12)6-10(13)14/h5,10H,3-4,6H2,1-2H3.
What are the key properties of N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3,6-dimethylpyridazine-4-carboxamide?
N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3,6-dimethylpyridazine-4-carboxamide has a molecular weight of 322.15 g/mol, XLogP of 2.20, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3,6-dimethylpyridazine-4-carboxamide is sourced from PubChem (CID 107491674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).