About 4-methyl-2,3-dihydro-1H-1,4-diazepin-5-one
4-methyl-2,3-dihydro-1H-1,4-diazepin-5-one (PubChem CID 10749190) has the molecular formula C6H10N2O
and a molecular weight of 126.16 g/mol. Its IUPAC name is 4-methyl-2,3-dihydro-1H-1,4-diazepin-5-one.
Molecular Properties
| Compound Name | 4-methyl-2,3-dihydro-1H-1,4-diazepin-5-one |
| PubChem CID | 10749190 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | 4-methyl-2,3-dihydro-1H-1,4-diazepin-5-one |
| SMILES | CN1CCNC=CC1=O |
| InChI | InChI=1S/C6H10N2O/c1-8-5-4-7-3-2-6(8)9/h2-3,7H,4-5H2,1H3 |
| InChIKey | MDELWJYGKDKADY-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-2,3-dihydro-1H-1,4-diazepin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,3-dihydro-1H-1,4-diazepin-5-one?
The IUPAC name of 4-methyl-2,3-dihydro-1H-1,4-diazepin-5-one (CID 10749190) is 4-methyl-2,3-dihydro-1H-1,4-diazepin-5-one.
What is the SMILES notation for 4-methyl-2,3-dihydro-1H-1,4-diazepin-5-one?
The canonical SMILES for 4-methyl-2,3-dihydro-1H-1,4-diazepin-5-one is CN1CCNC=CC1=O.
What is the InChIKey of 4-methyl-2,3-dihydro-1H-1,4-diazepin-5-one?
The InChIKey is MDELWJYGKDKADY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O/c1-8-5-4-7-3-2-6(8)9/h2-3,7H,4-5H2,1H3.
What are the key properties of 4-methyl-2,3-dihydro-1H-1,4-diazepin-5-one?
4-methyl-2,3-dihydro-1H-1,4-diazepin-5-one has a molecular weight of 126.16 g/mol, XLogP of -0.44, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,3-dihydro-1H-1,4-diazepin-5-one is sourced from PubChem (CID 10749190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).