C10H13ClF3N3OS — CID 107491953
N-(2-chloroethyl)-4-propyl-N-(2,2,2-trifluoroethyl)thiadiazole-5-carboxamide (PubChem CID 107491953) has the molecular formula C10H13ClF3N3OS and a molecular weight of 315.75 g/mol. Its IUPAC name is N-(2-chloroethyl)-4-propyl-N-(2,2,2-trifluoroethyl)thiadiazole-5-carboxamide.
| Compound Name | N-(2-chloroethyl)-4-propyl-N-(2,2,2-trifluoroethyl)thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 107491953 |
| Molecular Formula | C10H13ClF3N3OS |
| Molecular Weight | 315.75 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | N-(2-chloroethyl)-4-propyl-N-(2,2,2-trifluoroethyl)thiadiazole-5-carboxamide |
| SMILES | CCCc1nnsc1C(=O)N(CCCl)CC(F)(F)F |
| InChI | InChI=1S/C10H13ClF3N3OS/c1-2-3-7-8(19-16-15-7)9(18)17(5-4-11)6-10(12,13)14/h2-6H2,1H3 |
| InChIKey | XVASNQVVPXQKAI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.75 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|