C11H12BrF3N2O2 — CID 107492358
N-(2-bromoethyl)-2-methoxy-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide (PubChem CID 107492358) has the molecular formula C11H12BrF3N2O2 and a molecular weight of 341.13 g/mol. Its IUPAC name is N-(2-bromoethyl)-2-methoxy-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide.
| Compound Name | N-(2-bromoethyl)-2-methoxy-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 107492358 |
| Molecular Formula | C11H12BrF3N2O2 |
| Molecular Weight | 341.13 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | N-(2-bromoethyl)-2-methoxy-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide |
| SMILES | COc1ncccc1C(=O)N(CCBr)CC(F)(F)F |
| InChI | InChI=1S/C11H12BrF3N2O2/c1-19-9-8(3-2-5-16-9)10(18)17(6-4-12)7-11(13,14)15/h2-3,5H,4,6-7H2,1H3 |
| InChIKey | QVWGZJBBNKQMOX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.13 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|