C12H19BrF3NO2 — CID 107492382
N-(2-bromoethyl)-2,4,5-trimethyl-N-(2,2,2-trifluoroethyl)oxolane-3-carboxamide (PubChem CID 107492382) has the molecular formula C12H19BrF3NO2 and a molecular weight of 346.19 g/mol. Its IUPAC name is N-(2-bromoethyl)-2,4,5-trimethyl-N-(2,2,2-trifluoroethyl)oxolane-3-carboxamide.
| Compound Name | N-(2-bromoethyl)-2,4,5-trimethyl-N-(2,2,2-trifluoroethyl)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 107492382 |
| Molecular Formula | C12H19BrF3NO2 |
| Molecular Weight | 346.19 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | N-(2-bromoethyl)-2,4,5-trimethyl-N-(2,2,2-trifluoroethyl)oxolane-3-carboxamide |
| SMILES | CC1OC(C)C(C(=O)N(CCBr)CC(F)(F)F)C1C |
| InChI | InChI=1S/C12H19BrF3NO2/c1-7-8(2)19-9(3)10(7)11(18)17(5-4-13)6-12(14,15)16/h7-10H,4-6H2,1-3H3 |
| InChIKey | GSBWOQDTVLJNEX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.19 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|