C11H13BrF3N3O — CID 107492446
N-(2-bromoethyl)-3,6-dimethyl-N-(2,2,2-trifluoroethyl)pyridazine-4-carboxamide (PubChem CID 107492446) has the molecular formula C11H13BrF3N3O and a molecular weight of 340.14 g/mol. Its IUPAC name is N-(2-bromoethyl)-3,6-dimethyl-N-(2,2,2-trifluoroethyl)pyridazine-4-carboxamide.
| Compound Name | N-(2-bromoethyl)-3,6-dimethyl-N-(2,2,2-trifluoroethyl)pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 107492446 |
| Molecular Formula | C11H13BrF3N3O |
| Molecular Weight | 340.14 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | N-(2-bromoethyl)-3,6-dimethyl-N-(2,2,2-trifluoroethyl)pyridazine-4-carboxamide |
| SMILES | Cc1cc(C(=O)N(CCBr)CC(F)(F)F)c(C)nn1 |
| InChI | InChI=1S/C11H13BrF3N3O/c1-7-5-9(8(2)17-16-7)10(19)18(4-3-12)6-11(13,14)15/h5H,3-4,6H2,1-2H3 |
| InChIKey | NXWWPDJZXCLDNJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.14 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|