About N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2-methyl-1,3-thiazole-5-sulfonamide
N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2-methyl-1,3-thiazole-5-sulfonamide (PubChem CID 107492795) has the molecular formula C8H11BrF2N2O2S2
and a molecular weight of 349.22 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2-methyl-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2-methyl-1,3-thiazole-5-sulfonamide |
| PubChem CID | 107492795 |
| Molecular Formula | C8H11BrF2N2O2S2 |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 347.94 |
| IUPAC Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2-methyl-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1ncc(S(=O)(=O)N(CCBr)CC(F)F)s1 |
| InChI | InChI=1S/C8H11BrF2N2O2S2/c1-6-12-4-8(16-6)17(14,15)13(3-2-9)5-7(10)11/h4,7H,2-3,5H2,1H3 |
| InChIKey | GRQDLFUMLJTXJD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2-methyl-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2-methyl-1,3-thiazole-5-sulfonamide?
The IUPAC name of N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2-methyl-1,3-thiazole-5-sulfonamide (CID 107492795) is N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2-methyl-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2-methyl-1,3-thiazole-5-sulfonamide?
The canonical SMILES for N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2-methyl-1,3-thiazole-5-sulfonamide is Cc1ncc(S(=O)(=O)N(CCBr)CC(F)F)s1.
What is the InChIKey of N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2-methyl-1,3-thiazole-5-sulfonamide?
The InChIKey is GRQDLFUMLJTXJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11BrF2N2O2S2/c1-6-12-4-8(16-6)17(14,15)13(3-2-9)5-7(10)11/h4,7H,2-3,5H2,1H3.
What are the key properties of N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2-methyl-1,3-thiazole-5-sulfonamide?
N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2-methyl-1,3-thiazole-5-sulfonamide has a molecular weight of 349.22 g/mol, XLogP of 2.10, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2-methyl-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 107492795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).