C9H14ClF2N3O2S — CID 107492874
N-(2-chloroethyl)-N-(2,2-difluoroethyl)-1,2-dimethylimidazole-4-sulfonamide (PubChem CID 107492874) has the molecular formula C9H14ClF2N3O2S and a molecular weight of 301.75 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-(2,2-difluoroethyl)-1,2-dimethylimidazole-4-sulfonamide.
| Compound Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-1,2-dimethylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 107492874 |
| Molecular Formula | C9H14ClF2N3O2S |
| Molecular Weight | 301.75 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-1,2-dimethylimidazole-4-sulfonamide |
| SMILES | Cc1nc(S(=O)(=O)N(CCCl)CC(F)F)cn1C |
| InChI | InChI=1S/C9H14ClF2N3O2S/c1-7-13-9(6-14(7)2)18(16,17)15(4-3-10)5-8(11)12/h6,8H,3-5H2,1-2H3 |
| InChIKey | YSMFABHFDNHIJV-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.75 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|