C8H7Cl3F3NO2S2 — CID 107493010
2,5-dichloro-N-(2-chloroethyl)-N-(2,2,2-trifluoroethyl)thiophene-3-sulfonamide (PubChem CID 107493010) has the molecular formula C8H7Cl3F3NO2S2 and a molecular weight of 376.64 g/mol. Its IUPAC name is 2,5-dichloro-N-(2-chloroethyl)-N-(2,2,2-trifluoroethyl)thiophene-3-sulfonamide.
| Compound Name | 2,5-dichloro-N-(2-chloroethyl)-N-(2,2,2-trifluoroethyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 107493010 |
| Molecular Formula | C8H7Cl3F3NO2S2 |
| Molecular Weight | 376.64 g/mol |
| Exact Mass | 374.89 |
| IUPAC Name | 2,5-dichloro-N-(2-chloroethyl)-N-(2,2,2-trifluoroethyl)thiophene-3-sulfonamide |
| SMILES | O=S(=O)(c1cc(Cl)sc1Cl)N(CCCl)CC(F)(F)F |
| InChI | InChI=1S/C8H7Cl3F3NO2S2/c9-1-2-15(4-8(12,13)14)19(16,17)5-3-6(10)18-7(5)11/h3H,1-2,4H2 |
| InChIKey | XQGNQHHXZDFTCT-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.64 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|