About 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanehydrazide
3-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanehydrazide (PubChem CID 107493119) has the molecular formula C8H17F2N3O2
and a molecular weight of 225.24 g/mol. Its IUPAC name is 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanehydrazide.
Molecular Properties
| Compound Name | 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanehydrazide |
| PubChem CID | 107493119 |
| Molecular Formula | C8H17F2N3O2 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanehydrazide |
| SMILES | CC(CC(=O)NN)N(CCO)CC(F)F |
| InChI | InChI=1S/C8H17F2N3O2/c1-6(4-8(15)12-11)13(2-3-14)5-7(9)10/h6-7,14H,2-5,11H2,1H3,(H,12,15) |
| InChIKey | FNCXNUKEHHMAPV-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanehydrazide?
The IUPAC name of 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanehydrazide (CID 107493119) is 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanehydrazide.
What is the SMILES notation for 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanehydrazide?
The canonical SMILES for 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanehydrazide is CC(CC(=O)NN)N(CCO)CC(F)F.
What is the InChIKey of 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanehydrazide?
The InChIKey is FNCXNUKEHHMAPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17F2N3O2/c1-6(4-8(15)12-11)13(2-3-14)5-7(9)10/h6-7,14H,2-5,11H2,1H3,(H,12,15).
What are the key properties of 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanehydrazide?
3-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanehydrazide has a molecular weight of 225.24 g/mol, XLogP of -0.69, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanehydrazide is sourced from PubChem (CID 107493119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).