C9H13NO — CID 10749362
1-methyl-3a,4,5,6-tetrahydro-3H-indol-2-one (PubChem CID 10749362) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 1-methyl-3a,4,5,6-tetrahydro-3H-indol-2-one.
| Compound Name | 1-methyl-3a,4,5,6-tetrahydro-3H-indol-2-one |
|---|---|
| PubChem CID | 10749362 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 1-methyl-3a,4,5,6-tetrahydro-3H-indol-2-one |
| SMILES | CN1C(=O)CC2CCCC=C21 |
| InChI | InChI=1S/C9H13NO/c1-10-8-5-3-2-4-7(8)6-9(10)11/h5,7H,2-4,6H2,1H3 |
| InChIKey | PIRBYRAJXGFBTO-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |