C11H15N3O4S — CID 1074937
ethyl 4-amino-2-(2-ethoxy-2-oxoethyl)sulfanylpyrimidine-5-carboxylate (PubChem CID 1074937) has the molecular formula C11H15N3O4S and a molecular weight of 285.32 g/mol. Its IUPAC name is ethyl 4-amino-2-(2-ethoxy-2-oxoethyl)sulfanylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-amino-2-(2-ethoxy-2-oxoethyl)sulfanylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 1074937 |
| Molecular Formula | C11H15N3O4S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | ethyl 4-amino-2-(2-ethoxy-2-oxoethyl)sulfanylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)CSc1ncc(C(=O)OCC)c(N)n1 |
| InChI | InChI=1S/C11H15N3O4S/c1-3-17-8(15)6-19-11-13-5-7(9(12)14-11)10(16)18-4-2/h5H,3-4,6H2,1-2H3,(H2,12,13,14) |
| InChIKey | CBKZNEARDPSBAG-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 104.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |