About 1-[[2-aminoethyl(2,2-difluoroethyl)sulfamoyl]amino]-2-methylpropane
1-[[2-aminoethyl(2,2-difluoroethyl)sulfamoyl]amino]-2-methylpropane (PubChem CID 107493829) has the molecular formula C8H19F2N3O2S
and a molecular weight of 259.32 g/mol. Its IUPAC name is 1-[[2-aminoethyl(2,2-difluoroethyl)sulfamoyl]amino]-2-methylpropane.
Molecular Properties
| Compound Name | 1-[[2-aminoethyl(2,2-difluoroethyl)sulfamoyl]amino]-2-methylpropane |
| PubChem CID | 107493829 |
| Molecular Formula | C8H19F2N3O2S |
| Molecular Weight | 259.32 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 1-[[2-aminoethyl(2,2-difluoroethyl)sulfamoyl]amino]-2-methylpropane |
| SMILES | CC(C)CNS(=O)(=O)N(CCN)CC(F)F |
| InChI | InChI=1S/C8H19F2N3O2S/c1-7(2)5-12-16(14,15)13(4-3-11)6-8(9)10/h7-8,12H,3-6,11H2,1-2H3 |
| InChIKey | FIGQTUICHVFUKS-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.32 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[[2-aminoethyl(2,2-difluoroethyl)sulfamoyl]amino]-2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-aminoethyl(2,2-difluoroethyl)sulfamoyl]amino]-2-methylpropane?
The IUPAC name of 1-[[2-aminoethyl(2,2-difluoroethyl)sulfamoyl]amino]-2-methylpropane (CID 107493829) is 1-[[2-aminoethyl(2,2-difluoroethyl)sulfamoyl]amino]-2-methylpropane.
What is the SMILES notation for 1-[[2-aminoethyl(2,2-difluoroethyl)sulfamoyl]amino]-2-methylpropane?
The canonical SMILES for 1-[[2-aminoethyl(2,2-difluoroethyl)sulfamoyl]amino]-2-methylpropane is CC(C)CNS(=O)(=O)N(CCN)CC(F)F.
What is the InChIKey of 1-[[2-aminoethyl(2,2-difluoroethyl)sulfamoyl]amino]-2-methylpropane?
The InChIKey is FIGQTUICHVFUKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19F2N3O2S/c1-7(2)5-12-16(14,15)13(4-3-11)6-8(9)10/h7-8,12H,3-6,11H2,1-2H3.
What are the key properties of 1-[[2-aminoethyl(2,2-difluoroethyl)sulfamoyl]amino]-2-methylpropane?
1-[[2-aminoethyl(2,2-difluoroethyl)sulfamoyl]amino]-2-methylpropane has a molecular weight of 259.32 g/mol, XLogP of 0.00, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-aminoethyl(2,2-difluoroethyl)sulfamoyl]amino]-2-methylpropane is sourced from PubChem (CID 107493829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).