About 2-[2-aminoethyl(ethylsulfamoyl)amino]-1,1-difluoroethane
2-[2-aminoethyl(ethylsulfamoyl)amino]-1,1-difluoroethane (PubChem CID 107493861) has the molecular formula C6H15F2N3O2S
and a molecular weight of 231.27 g/mol. Its IUPAC name is 2-[2-aminoethyl(ethylsulfamoyl)amino]-1,1-difluoroethane.
Molecular Properties
| Compound Name | 2-[2-aminoethyl(ethylsulfamoyl)amino]-1,1-difluoroethane |
| PubChem CID | 107493861 |
| Molecular Formula | C6H15F2N3O2S |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 2-[2-aminoethyl(ethylsulfamoyl)amino]-1,1-difluoroethane |
| SMILES | CCNS(=O)(=O)N(CCN)CC(F)F |
| InChI | InChI=1S/C6H15F2N3O2S/c1-2-10-14(12,13)11(4-3-9)5-6(7)8/h6,10H,2-5,9H2,1H3 |
| InChIKey | GFHOOIPLJFKTTL-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-aminoethyl(ethylsulfamoyl)amino]-1,1-difluoroethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-aminoethyl(ethylsulfamoyl)amino]-1,1-difluoroethane?
The IUPAC name of 2-[2-aminoethyl(ethylsulfamoyl)amino]-1,1-difluoroethane (CID 107493861) is 2-[2-aminoethyl(ethylsulfamoyl)amino]-1,1-difluoroethane.
What is the SMILES notation for 2-[2-aminoethyl(ethylsulfamoyl)amino]-1,1-difluoroethane?
The canonical SMILES for 2-[2-aminoethyl(ethylsulfamoyl)amino]-1,1-difluoroethane is CCNS(=O)(=O)N(CCN)CC(F)F.
What is the InChIKey of 2-[2-aminoethyl(ethylsulfamoyl)amino]-1,1-difluoroethane?
The InChIKey is GFHOOIPLJFKTTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15F2N3O2S/c1-2-10-14(12,13)11(4-3-9)5-6(7)8/h6,10H,2-5,9H2,1H3.
What are the key properties of 2-[2-aminoethyl(ethylsulfamoyl)amino]-1,1-difluoroethane?
2-[2-aminoethyl(ethylsulfamoyl)amino]-1,1-difluoroethane has a molecular weight of 231.27 g/mol, XLogP of -0.63, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-aminoethyl(ethylsulfamoyl)amino]-1,1-difluoroethane is sourced from PubChem (CID 107493861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).