About N'-(2,2-difluoroethyl)-N'-(dimethylsulfamoyl)ethane-1,2-diamine
N'-(2,2-difluoroethyl)-N'-(dimethylsulfamoyl)ethane-1,2-diamine (PubChem CID 107493872) has the molecular formula C6H15F2N3O2S
and a molecular weight of 231.27 g/mol. Its IUPAC name is N'-(2,2-difluoroethyl)-N'-(dimethylsulfamoyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(2,2-difluoroethyl)-N'-(dimethylsulfamoyl)ethane-1,2-diamine |
| PubChem CID | 107493872 |
| Molecular Formula | C6H15F2N3O2S |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | N'-(2,2-difluoroethyl)-N'-(dimethylsulfamoyl)ethane-1,2-diamine |
| SMILES | CN(C)S(=O)(=O)N(CCN)CC(F)F |
| InChI | InChI=1S/C6H15F2N3O2S/c1-10(2)14(12,13)11(4-3-9)5-6(7)8/h6H,3-5,9H2,1-2H3 |
| InChIKey | HKFWQFUYUFSHQN-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-(2,2-difluoroethyl)-N'-(dimethylsulfamoyl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2,2-difluoroethyl)-N'-(dimethylsulfamoyl)ethane-1,2-diamine?
The IUPAC name of N'-(2,2-difluoroethyl)-N'-(dimethylsulfamoyl)ethane-1,2-diamine (CID 107493872) is N'-(2,2-difluoroethyl)-N'-(dimethylsulfamoyl)ethane-1,2-diamine.
What is the SMILES notation for N'-(2,2-difluoroethyl)-N'-(dimethylsulfamoyl)ethane-1,2-diamine?
The canonical SMILES for N'-(2,2-difluoroethyl)-N'-(dimethylsulfamoyl)ethane-1,2-diamine is CN(C)S(=O)(=O)N(CCN)CC(F)F.
What is the InChIKey of N'-(2,2-difluoroethyl)-N'-(dimethylsulfamoyl)ethane-1,2-diamine?
The InChIKey is HKFWQFUYUFSHQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15F2N3O2S/c1-10(2)14(12,13)11(4-3-9)5-6(7)8/h6H,3-5,9H2,1-2H3.
What are the key properties of N'-(2,2-difluoroethyl)-N'-(dimethylsulfamoyl)ethane-1,2-diamine?
N'-(2,2-difluoroethyl)-N'-(dimethylsulfamoyl)ethane-1,2-diamine has a molecular weight of 231.27 g/mol, XLogP of -0.68, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2,2-difluoroethyl)-N'-(dimethylsulfamoyl)ethane-1,2-diamine is sourced from PubChem (CID 107493872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).