About 2-[2-aminoethyl(methylsulfamoyl)amino]-1,1,1-trifluoroethane
2-[2-aminoethyl(methylsulfamoyl)amino]-1,1,1-trifluoroethane (PubChem CID 107493881) has the molecular formula C5H12F3N3O2S
and a molecular weight of 235.23 g/mol. Its IUPAC name is 2-[2-aminoethyl(methylsulfamoyl)amino]-1,1,1-trifluoroethane.
Molecular Properties
| Compound Name | 2-[2-aminoethyl(methylsulfamoyl)amino]-1,1,1-trifluoroethane |
| PubChem CID | 107493881 |
| Molecular Formula | C5H12F3N3O2S |
| Molecular Weight | 235.23 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 2-[2-aminoethyl(methylsulfamoyl)amino]-1,1,1-trifluoroethane |
| SMILES | CNS(=O)(=O)N(CCN)CC(F)(F)F |
| InChI | InChI=1S/C5H12F3N3O2S/c1-10-14(12,13)11(3-2-9)4-5(6,7)8/h10H,2-4,9H2,1H3 |
| InChIKey | SJVLNVWKHNFUDD-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.23 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-aminoethyl(methylsulfamoyl)amino]-1,1,1-trifluoroethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-aminoethyl(methylsulfamoyl)amino]-1,1,1-trifluoroethane?
The IUPAC name of 2-[2-aminoethyl(methylsulfamoyl)amino]-1,1,1-trifluoroethane (CID 107493881) is 2-[2-aminoethyl(methylsulfamoyl)amino]-1,1,1-trifluoroethane.
What is the SMILES notation for 2-[2-aminoethyl(methylsulfamoyl)amino]-1,1,1-trifluoroethane?
The canonical SMILES for 2-[2-aminoethyl(methylsulfamoyl)amino]-1,1,1-trifluoroethane is CNS(=O)(=O)N(CCN)CC(F)(F)F.
What is the InChIKey of 2-[2-aminoethyl(methylsulfamoyl)amino]-1,1,1-trifluoroethane?
The InChIKey is SJVLNVWKHNFUDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12F3N3O2S/c1-10-14(12,13)11(3-2-9)4-5(6,7)8/h10H,2-4,9H2,1H3.
What are the key properties of 2-[2-aminoethyl(methylsulfamoyl)amino]-1,1,1-trifluoroethane?
2-[2-aminoethyl(methylsulfamoyl)amino]-1,1,1-trifluoroethane has a molecular weight of 235.23 g/mol, XLogP of -0.73, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-aminoethyl(methylsulfamoyl)amino]-1,1,1-trifluoroethane is sourced from PubChem (CID 107493881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).