About 2-[[2-aminoethyl(2,2,2-trifluoroethyl)sulfamoyl]amino]-2-methylpropane
2-[[2-aminoethyl(2,2,2-trifluoroethyl)sulfamoyl]amino]-2-methylpropane (PubChem CID 107493943) has the molecular formula C8H18F3N3O2S
and a molecular weight of 277.31 g/mol. Its IUPAC name is 2-[[2-aminoethyl(2,2,2-trifluoroethyl)sulfamoyl]amino]-2-methylpropane.
Molecular Properties
| Compound Name | 2-[[2-aminoethyl(2,2,2-trifluoroethyl)sulfamoyl]amino]-2-methylpropane |
| PubChem CID | 107493943 |
| Molecular Formula | C8H18F3N3O2S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 2-[[2-aminoethyl(2,2,2-trifluoroethyl)sulfamoyl]amino]-2-methylpropane |
| SMILES | CC(C)(C)NS(=O)(=O)N(CCN)CC(F)(F)F |
| InChI | InChI=1S/C8H18F3N3O2S/c1-7(2,3)13-17(15,16)14(5-4-12)6-8(9,10)11/h13H,4-6,12H2,1-3H3 |
| InChIKey | BEUSQPOPJSFVCS-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[2-aminoethyl(2,2,2-trifluoroethyl)sulfamoyl]amino]-2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-aminoethyl(2,2,2-trifluoroethyl)sulfamoyl]amino]-2-methylpropane?
The IUPAC name of 2-[[2-aminoethyl(2,2,2-trifluoroethyl)sulfamoyl]amino]-2-methylpropane (CID 107493943) is 2-[[2-aminoethyl(2,2,2-trifluoroethyl)sulfamoyl]amino]-2-methylpropane.
What is the SMILES notation for 2-[[2-aminoethyl(2,2,2-trifluoroethyl)sulfamoyl]amino]-2-methylpropane?
The canonical SMILES for 2-[[2-aminoethyl(2,2,2-trifluoroethyl)sulfamoyl]amino]-2-methylpropane is CC(C)(C)NS(=O)(=O)N(CCN)CC(F)(F)F.
What is the InChIKey of 2-[[2-aminoethyl(2,2,2-trifluoroethyl)sulfamoyl]amino]-2-methylpropane?
The InChIKey is BEUSQPOPJSFVCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18F3N3O2S/c1-7(2,3)13-17(15,16)14(5-4-12)6-8(9,10)11/h13H,4-6,12H2,1-3H3.
What are the key properties of 2-[[2-aminoethyl(2,2,2-trifluoroethyl)sulfamoyl]amino]-2-methylpropane?
2-[[2-aminoethyl(2,2,2-trifluoroethyl)sulfamoyl]amino]-2-methylpropane has a molecular weight of 277.31 g/mol, XLogP of 0.44, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-aminoethyl(2,2,2-trifluoroethyl)sulfamoyl]amino]-2-methylpropane is sourced from PubChem (CID 107493943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).