About N'-(2,2-difluoroethyl)-N'-(2-methylpyrimidin-4-yl)ethane-1,2-diamine
N'-(2,2-difluoroethyl)-N'-(2-methylpyrimidin-4-yl)ethane-1,2-diamine (PubChem CID 107493991) has the molecular formula C9H14F2N4
and a molecular weight of 216.24 g/mol. Its IUPAC name is N'-(2,2-difluoroethyl)-N'-(2-methylpyrimidin-4-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(2,2-difluoroethyl)-N'-(2-methylpyrimidin-4-yl)ethane-1,2-diamine |
| PubChem CID | 107493991 |
| Molecular Formula | C9H14F2N4 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | N'-(2,2-difluoroethyl)-N'-(2-methylpyrimidin-4-yl)ethane-1,2-diamine |
| SMILES | Cc1nccc(N(CCN)CC(F)F)n1 |
| InChI | InChI=1S/C9H14F2N4/c1-7-13-4-2-9(14-7)15(5-3-12)6-8(10)11/h2,4,8H,3,5-6,12H2,1H3 |
| InChIKey | XUTNYGRQGHPSTF-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-(2,2-difluoroethyl)-N'-(2-methylpyrimidin-4-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2,2-difluoroethyl)-N'-(2-methylpyrimidin-4-yl)ethane-1,2-diamine?
The IUPAC name of N'-(2,2-difluoroethyl)-N'-(2-methylpyrimidin-4-yl)ethane-1,2-diamine (CID 107493991) is N'-(2,2-difluoroethyl)-N'-(2-methylpyrimidin-4-yl)ethane-1,2-diamine.
What is the SMILES notation for N'-(2,2-difluoroethyl)-N'-(2-methylpyrimidin-4-yl)ethane-1,2-diamine?
The canonical SMILES for N'-(2,2-difluoroethyl)-N'-(2-methylpyrimidin-4-yl)ethane-1,2-diamine is Cc1nccc(N(CCN)CC(F)F)n1.
What is the InChIKey of N'-(2,2-difluoroethyl)-N'-(2-methylpyrimidin-4-yl)ethane-1,2-diamine?
The InChIKey is XUTNYGRQGHPSTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F2N4/c1-7-13-4-2-9(14-7)15(5-3-12)6-8(10)11/h2,4,8H,3,5-6,12H2,1H3.
What are the key properties of N'-(2,2-difluoroethyl)-N'-(2-methylpyrimidin-4-yl)ethane-1,2-diamine?
N'-(2,2-difluoroethyl)-N'-(2-methylpyrimidin-4-yl)ethane-1,2-diamine has a molecular weight of 216.24 g/mol, XLogP of 0.82, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2,2-difluoroethyl)-N'-(2-methylpyrimidin-4-yl)ethane-1,2-diamine is sourced from PubChem (CID 107493991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).