C13H19F2N3O — CID 107494405
2-[2-aminoethyl(2,2-difluoroethyl)amino]-N-phenylpropanamide (PubChem CID 107494405) has the molecular formula C13H19F2N3O and a molecular weight of 271.31 g/mol. Its IUPAC name is 2-[2-aminoethyl(2,2-difluoroethyl)amino]-N-phenylpropanamide.
| Compound Name | 2-[2-aminoethyl(2,2-difluoroethyl)amino]-N-phenylpropanamide |
|---|---|
| PubChem CID | 107494405 |
| Molecular Formula | C13H19F2N3O |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 2-[2-aminoethyl(2,2-difluoroethyl)amino]-N-phenylpropanamide |
| SMILES | CC(C(=O)Nc1ccccc1)N(CCN)CC(F)F |
| InChI | InChI=1S/C13H19F2N3O/c1-10(18(8-7-16)9-12(14)15)13(19)17-11-5-3-2-4-6-11/h2-6,10,12H,7-9,16H2,1H3,(H,17,19) |
| InChIKey | GFSBIHWFRABBTQ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |