About N-[(3R,4S)-4-methyl-2-oxooxolan-3-yl]acetamide
N-[(3R,4S)-4-methyl-2-oxooxolan-3-yl]acetamide (PubChem CID 10749443) has the molecular formula C7H11NO3
and a molecular weight of 157.17 g/mol. Its IUPAC name is N-[(3R,4S)-4-methyl-2-oxooxolan-3-yl]acetamide.
Molecular Properties
| Compound Name | N-[(3R,4S)-4-methyl-2-oxooxolan-3-yl]acetamide |
| PubChem CID | 10749443 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | N-[(3R,4S)-4-methyl-2-oxooxolan-3-yl]acetamide |
| SMILES | CC(=O)N[C@H]1C(=O)OC[C@H]1C |
| InChI | InChI=1S/C7H11NO3/c1-4-3-11-7(10)6(4)8-5(2)9/h4,6H,3H2,1-2H3,(H,8,9)/t4-,6-/m1/s1 |
| InChIKey | ABNUGWRZSYVEEW-INEUFUBQSA-N |
| XLogP | -0.32 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(3R,4S)-4-methyl-2-oxooxolan-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3R,4S)-4-methyl-2-oxooxolan-3-yl]acetamide?
The IUPAC name of N-[(3R,4S)-4-methyl-2-oxooxolan-3-yl]acetamide (CID 10749443) is N-[(3R,4S)-4-methyl-2-oxooxolan-3-yl]acetamide.
What is the SMILES notation for N-[(3R,4S)-4-methyl-2-oxooxolan-3-yl]acetamide?
The canonical SMILES for N-[(3R,4S)-4-methyl-2-oxooxolan-3-yl]acetamide is CC(=O)N[C@H]1C(=O)OC[C@H]1C.
What is the InChIKey of N-[(3R,4S)-4-methyl-2-oxooxolan-3-yl]acetamide?
The InChIKey is ABNUGWRZSYVEEW-INEUFUBQSA-N. The full InChI is InChI=1S/C7H11NO3/c1-4-3-11-7(10)6(4)8-5(2)9/h4,6H,3H2,1-2H3,(H,8,9)/t4-,6-/m1/s1.
What are the key properties of N-[(3R,4S)-4-methyl-2-oxooxolan-3-yl]acetamide?
N-[(3R,4S)-4-methyl-2-oxooxolan-3-yl]acetamide has a molecular weight of 157.17 g/mol, XLogP of -0.32, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3R,4S)-4-methyl-2-oxooxolan-3-yl]acetamide is sourced from PubChem (CID 10749443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).