C8H15NO2 — CID 10749447
[(3S,3aS,6aS)-4-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-3-yl]methanol (PubChem CID 10749447) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is [(3S,3aS,6aS)-4-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-3-yl]methanol.
| Compound Name | [(3S,3aS,6aS)-4-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-3-yl]methanol |
|---|---|
| PubChem CID | 10749447 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | [(3S,3aS,6aS)-4-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-3-yl]methanol |
| SMILES | CN1CC[C@@H]2OC[C@H](CO)[C@@H]21 |
| InChI | InChI=1S/C8H15NO2/c1-9-3-2-7-8(9)6(4-10)5-11-7/h6-8,10H,2-5H2,1H3/t6-,7-,8-/m0/s1 |
| InChIKey | JYLRKRHZRQQGSZ-FXQIFTODSA-N |
| XLogP | -0.30 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |