C6H13F2N3O — CID 107494484
2-[2-aminoethyl(2,2-difluoroethyl)amino]acetamide (PubChem CID 107494484) has the molecular formula C6H13F2N3O and a molecular weight of 181.19 g/mol. Its IUPAC name is 2-[2-aminoethyl(2,2-difluoroethyl)amino]acetamide.
| Compound Name | 2-[2-aminoethyl(2,2-difluoroethyl)amino]acetamide |
|---|---|
| PubChem CID | 107494484 |
| Molecular Formula | C6H13F2N3O |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | 2-[2-aminoethyl(2,2-difluoroethyl)amino]acetamide |
| SMILES | NCCN(CC(N)=O)CC(F)F |
| InChI | InChI=1S/C6H13F2N3O/c7-5(8)3-11(2-1-9)4-6(10)12/h5H,1-4,9H2,(H2,10,12) |
| InChIKey | WYLJVYFWARNZBG-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |