About 2-[2-aminoethyl(2,2-difluoroethyl)amino]acetamide
2-[2-aminoethyl(2,2-difluoroethyl)amino]acetamide (PubChem CID 107494484) has the molecular formula C6H13F2N3O
and a molecular weight of 181.19 g/mol. Its IUPAC name is 2-[2-aminoethyl(2,2-difluoroethyl)amino]acetamide.
Molecular Properties
| Compound Name | 2-[2-aminoethyl(2,2-difluoroethyl)amino]acetamide |
| PubChem CID | 107494484 |
| Molecular Formula | C6H13F2N3O |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | 2-[2-aminoethyl(2,2-difluoroethyl)amino]acetamide |
| SMILES | NCCN(CC(N)=O)CC(F)F |
| InChI | InChI=1S/C6H13F2N3O/c7-5(8)3-11(2-1-9)4-6(10)12/h5H,1-4,9H2,(H2,10,12) |
| InChIKey | WYLJVYFWARNZBG-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-aminoethyl(2,2-difluoroethyl)amino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-aminoethyl(2,2-difluoroethyl)amino]acetamide?
The IUPAC name of 2-[2-aminoethyl(2,2-difluoroethyl)amino]acetamide (CID 107494484) is 2-[2-aminoethyl(2,2-difluoroethyl)amino]acetamide.
What is the SMILES notation for 2-[2-aminoethyl(2,2-difluoroethyl)amino]acetamide?
The canonical SMILES for 2-[2-aminoethyl(2,2-difluoroethyl)amino]acetamide is NCCN(CC(N)=O)CC(F)F.
What is the InChIKey of 2-[2-aminoethyl(2,2-difluoroethyl)amino]acetamide?
The InChIKey is WYLJVYFWARNZBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13F2N3O/c7-5(8)3-11(2-1-9)4-6(10)12/h5H,1-4,9H2,(H2,10,12).
What are the key properties of 2-[2-aminoethyl(2,2-difluoroethyl)amino]acetamide?
2-[2-aminoethyl(2,2-difluoroethyl)amino]acetamide has a molecular weight of 181.19 g/mol, XLogP of -1.00, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-aminoethyl(2,2-difluoroethyl)amino]acetamide is sourced from PubChem (CID 107494484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).