About N'-(2,2-difluoroethyl)-N'-(1-oxaspiro[4.5]decan-2-ylmethyl)ethane-1,2-diamine
N'-(2,2-difluoroethyl)-N'-(1-oxaspiro[4.5]decan-2-ylmethyl)ethane-1,2-diamine (PubChem CID 107494520) has the molecular formula C14H26F2N2O
and a molecular weight of 276.37 g/mol. Its IUPAC name is N'-(2,2-difluoroethyl)-N'-(1-oxaspiro[4.5]decan-2-ylmethyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(2,2-difluoroethyl)-N'-(1-oxaspiro[4.5]decan-2-ylmethyl)ethane-1,2-diamine |
| PubChem CID | 107494520 |
| Molecular Formula | C14H26F2N2O |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | N'-(2,2-difluoroethyl)-N'-(1-oxaspiro[4.5]decan-2-ylmethyl)ethane-1,2-diamine |
| SMILES | NCCN(CC(F)F)CC1CCC2(CCCCC2)O1 |
| InChI | InChI=1S/C14H26F2N2O/c15-13(16)11-18(9-8-17)10-12-4-7-14(19-12)5-2-1-3-6-14/h12-13H,1-11,17H2 |
| InChIKey | WFAFWJBDMNNGAG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-(2,2-difluoroethyl)-N'-(1-oxaspiro[4.5]decan-2-ylmethyl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2,2-difluoroethyl)-N'-(1-oxaspiro[4.5]decan-2-ylmethyl)ethane-1,2-diamine?
The IUPAC name of N'-(2,2-difluoroethyl)-N'-(1-oxaspiro[4.5]decan-2-ylmethyl)ethane-1,2-diamine (CID 107494520) is N'-(2,2-difluoroethyl)-N'-(1-oxaspiro[4.5]decan-2-ylmethyl)ethane-1,2-diamine.
What is the SMILES notation for N'-(2,2-difluoroethyl)-N'-(1-oxaspiro[4.5]decan-2-ylmethyl)ethane-1,2-diamine?
The canonical SMILES for N'-(2,2-difluoroethyl)-N'-(1-oxaspiro[4.5]decan-2-ylmethyl)ethane-1,2-diamine is NCCN(CC(F)F)CC1CCC2(CCCCC2)O1.
What is the InChIKey of N'-(2,2-difluoroethyl)-N'-(1-oxaspiro[4.5]decan-2-ylmethyl)ethane-1,2-diamine?
The InChIKey is WFAFWJBDMNNGAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26F2N2O/c15-13(16)11-18(9-8-17)10-12-4-7-14(19-12)5-2-1-3-6-14/h12-13H,1-11,17H2.
What are the key properties of N'-(2,2-difluoroethyl)-N'-(1-oxaspiro[4.5]decan-2-ylmethyl)ethane-1,2-diamine?
N'-(2,2-difluoroethyl)-N'-(1-oxaspiro[4.5]decan-2-ylmethyl)ethane-1,2-diamine has a molecular weight of 276.37 g/mol, XLogP of 2.39, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2,2-difluoroethyl)-N'-(1-oxaspiro[4.5]decan-2-ylmethyl)ethane-1,2-diamine is sourced from PubChem (CID 107494520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).