C11H23F2N3O — CID 107494579
2-[2-aminoethyl(2,2-difluoroethyl)amino]-N-butylpropanamide (PubChem CID 107494579) has the molecular formula C11H23F2N3O and a molecular weight of 251.32 g/mol. Its IUPAC name is 2-[2-aminoethyl(2,2-difluoroethyl)amino]-N-butylpropanamide.
| Compound Name | 2-[2-aminoethyl(2,2-difluoroethyl)amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 107494579 |
| Molecular Formula | C11H23F2N3O |
| Molecular Weight | 251.32 g/mol |
| Exact Mass | 251.18 |
| IUPAC Name | 2-[2-aminoethyl(2,2-difluoroethyl)amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)C(C)N(CCN)CC(F)F |
| InChI | InChI=1S/C11H23F2N3O/c1-3-4-6-15-11(17)9(2)16(7-5-14)8-10(12)13/h9-10H,3-8,14H2,1-2H3,(H,15,17) |
| InChIKey | NDQSWDADUWSGNH-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.32 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|