C8H12F2N4O — CID 107495031
2-[(5-aminopyrazin-2-yl)-(2,2-difluoroethyl)amino]ethanol (PubChem CID 107495031) has the molecular formula C8H12F2N4O and a molecular weight of 218.21 g/mol. Its IUPAC name is 2-[(5-aminopyrazin-2-yl)-(2,2-difluoroethyl)amino]ethanol.
| Compound Name | 2-[(5-aminopyrazin-2-yl)-(2,2-difluoroethyl)amino]ethanol |
|---|---|
| PubChem CID | 107495031 |
| Molecular Formula | C8H12F2N4O |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | 2-[(5-aminopyrazin-2-yl)-(2,2-difluoroethyl)amino]ethanol |
| SMILES | Nc1cnc(N(CCO)CC(F)F)cn1 |
| InChI | InChI=1S/C8H12F2N4O/c9-6(10)5-14(1-2-15)8-4-12-7(11)3-13-8/h3-4,6,15H,1-2,5H2,(H2,11,12) |
| InChIKey | VVGWTTBAFGFADW-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |