C11H14O — CID 10749508
(E,4E)-4-cyclohex-2-en-1-ylidene-3-methylbut-2-enal (PubChem CID 10749508) has the molecular formula C11H14O and a molecular weight of 162.23 g/mol. Its IUPAC name is (E,4E)-4-cyclohex-2-en-1-ylidene-3-methylbut-2-enal.
| Compound Name | (E,4E)-4-cyclohex-2-en-1-ylidene-3-methylbut-2-enal |
|---|---|
| PubChem CID | 10749508 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | (E,4E)-4-cyclohex-2-en-1-ylidene-3-methylbut-2-enal |
| SMILES | CC(=C\C=O)/C=C1/C=CCCC1 |
| InChI | InChI=1S/C11H14O/c1-10(7-8-12)9-11-5-3-2-4-6-11/h3,5,7-9H,2,4,6H2,1H3/b10-7+,11-9- |
| InChIKey | ZSYSVXOPFBXJNK-BDFJVSTISA-N |
| XLogP | 2.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|