About thieno[2,3-c]pyridine-2-carbaldehyde
thieno[2,3-c]pyridine-2-carbaldehyde (PubChem CID 10749527) has the molecular formula C8H5NOS
and a molecular weight of 163.20 g/mol. Its IUPAC name is thieno[2,3-c]pyridine-2-carbaldehyde.
Molecular Properties
| Compound Name | thieno[2,3-c]pyridine-2-carbaldehyde |
| PubChem CID | 10749527 |
| Molecular Formula | C8H5NOS |
| Molecular Weight | 163.20 g/mol |
| Exact Mass | 163.01 |
| IUPAC Name | thieno[2,3-c]pyridine-2-carbaldehyde |
| SMILES | O=Cc1cc2ccncc2s1 |
| InChI | InChI=1S/C8H5NOS/c10-5-7-3-6-1-2-9-4-8(6)11-7/h1-5H |
| InChIKey | WVSKUUMKOLSXHM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.20 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze thieno[2,3-c]pyridine-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[2,3-c]pyridine-2-carbaldehyde?
The IUPAC name of thieno[2,3-c]pyridine-2-carbaldehyde (CID 10749527) is thieno[2,3-c]pyridine-2-carbaldehyde.
What is the SMILES notation for thieno[2,3-c]pyridine-2-carbaldehyde?
The canonical SMILES for thieno[2,3-c]pyridine-2-carbaldehyde is O=Cc1cc2ccncc2s1.
What is the InChIKey of thieno[2,3-c]pyridine-2-carbaldehyde?
The InChIKey is WVSKUUMKOLSXHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NOS/c10-5-7-3-6-1-2-9-4-8(6)11-7/h1-5H.
What are the key properties of thieno[2,3-c]pyridine-2-carbaldehyde?
thieno[2,3-c]pyridine-2-carbaldehyde has a molecular weight of 163.20 g/mol, XLogP of 2.11, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[2,3-c]pyridine-2-carbaldehyde is sourced from PubChem (CID 10749527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).