C9H11NO2 — CID 10749555
(1R,2S,6R,7S)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 10749555) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is (1R,2S,6R,7S)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2S,6R,7S)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 10749555 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | (1R,2S,6R,7S)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | O=C1NC(=O)[C@H]2[C@@H]3CC[C@@H](C3)[C@@H]12 |
| InChI | InChI=1S/C9H11NO2/c11-8-6-4-1-2-5(3-4)7(6)9(12)10-8/h4-7H,1-3H2,(H,10,11,12)/t4-,5+,6+,7- |
| InChIKey | RIVOBMOBWMOLDJ-RNGGSSJXSA-N |
| XLogP | 0.31 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|