C13H15FN4O — CID 107495694
1-(2-aminoethyl)-N-[(2-fluorophenyl)methyl]imidazole-4-carboxamide (PubChem CID 107495694) has the molecular formula C13H15FN4O and a molecular weight of 262.29 g/mol. Its IUPAC name is 1-(2-aminoethyl)-N-[(2-fluorophenyl)methyl]imidazole-4-carboxamide.
| Compound Name | 1-(2-aminoethyl)-N-[(2-fluorophenyl)methyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 107495694 |
| Molecular Formula | C13H15FN4O |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 1-(2-aminoethyl)-N-[(2-fluorophenyl)methyl]imidazole-4-carboxamide |
| SMILES | NCCn1cnc(C(=O)NCc2ccccc2F)c1 |
| InChI | InChI=1S/C13H15FN4O/c14-11-4-2-1-3-10(11)7-16-13(19)12-8-18(6-5-15)9-17-12/h1-4,8-9H,5-7,15H2,(H,16,19) |
| InChIKey | GENIGMGDKASLLO-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |