5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxylic acid

C8H10N2O2 — CID 10749571

IUPAC5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxylic acid
SMILESO=C(O)C1CCn2cncc2C1
InChIInChI=1S/C8H10N2O2/c11-8(12)6-1-2-10-5-9-4-7(10)3-6/h4-6H,1-3H2,(H,11,12)
InChIKeyJIASDMFGYACABF-UHFFFAOYSA-N
MW166.18 g/mol
LogP0.53
Rot. Bonds1

About 5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxylic acid

5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxylic acid (PubChem CID 10749571) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is 5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxylic acid.

Molecular Properties

Compound Name5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxylic acid
PubChem CID10749571
Molecular FormulaC8H10N2O2
Molecular Weight166.18 g/mol
Exact Mass166.07
IUPAC Name5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxylic acid
SMILESO=C(O)C1CCn2cncc2C1
InChIInChI=1S/C8H10N2O2/c11-8(12)6-1-2-10-5-9-4-7(10)3-6/h4-6H,1-3H2,(H,11,12)
InChIKeyJIASDMFGYACABF-UHFFFAOYSA-N
XLogP0.53
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500166.18
LogP ≤ 50.53
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxylic acid?
The IUPAC name of 5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxylic acid (CID 10749571) is 5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxylic acid.
What is the SMILES notation for 5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxylic acid?
The canonical SMILES for 5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxylic acid is O=C(O)C1CCn2cncc2C1.
What is the InChIKey of 5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxylic acid?
The InChIKey is JIASDMFGYACABF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2/c11-8(12)6-1-2-10-5-9-4-7(10)3-6/h4-6H,1-3H2,(H,11,12).
What are the key properties of 5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxylic acid?
5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxylic acid has a molecular weight of 166.18 g/mol, XLogP of 0.53, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxylic acid is sourced from PubChem (CID 10749571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).