C9H16N2O — CID 10749633
(3aR,7aS)-1,3-dimethyl-3a,4,5,6,7,7a-hexahydrobenzimidazol-2-one (PubChem CID 10749633) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is (3aR,7aS)-1,3-dimethyl-3a,4,5,6,7,7a-hexahydrobenzimidazol-2-one.
| Compound Name | (3aR,7aS)-1,3-dimethyl-3a,4,5,6,7,7a-hexahydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 10749633 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | (3aR,7aS)-1,3-dimethyl-3a,4,5,6,7,7a-hexahydrobenzimidazol-2-one |
| SMILES | CN1C(=O)N(C)[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C9H16N2O/c1-10-7-5-3-4-6-8(7)11(2)9(10)12/h7-8H,3-6H2,1-2H3/t7-,8+ |
| InChIKey | ZEKWOCRWCZGATK-OCAPTIKFSA-N |
| XLogP | 1.29 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |