C11H14F3N3O4 — CID 107496731
1-[2-[3-(2,2,2-trifluoroethoxy)propanoylamino]ethyl]imidazole-4-carboxylic acid (PubChem CID 107496731) has the molecular formula C11H14F3N3O4 and a molecular weight of 309.24 g/mol. Its IUPAC name is 1-[2-[3-(2,2,2-trifluoroethoxy)propanoylamino]ethyl]imidazole-4-carboxylic acid.
| Compound Name | 1-[2-[3-(2,2,2-trifluoroethoxy)propanoylamino]ethyl]imidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 107496731 |
| Molecular Formula | C11H14F3N3O4 |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 1-[2-[3-(2,2,2-trifluoroethoxy)propanoylamino]ethyl]imidazole-4-carboxylic acid |
| SMILES | O=C(CCOCC(F)(F)F)NCCn1cnc(C(=O)O)c1 |
| InChI | InChI=1S/C11H14F3N3O4/c12-11(13,14)6-21-4-1-9(18)15-2-3-17-5-8(10(19)20)16-7-17/h5,7H,1-4,6H2,(H,15,18)(H,19,20) |
| InChIKey | INHGREXRHYVUMC-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|