C12H20N4O4 — CID 107497167
1-[2-[[1-methoxypropan-2-yl(methyl)carbamoyl]amino]ethyl]imidazole-4-carboxylic acid (PubChem CID 107497167) has the molecular formula C12H20N4O4 and a molecular weight of 284.32 g/mol. Its IUPAC name is 1-[2-[[1-methoxypropan-2-yl(methyl)carbamoyl]amino]ethyl]imidazole-4-carboxylic acid.
| Compound Name | 1-[2-[[1-methoxypropan-2-yl(methyl)carbamoyl]amino]ethyl]imidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 107497167 |
| Molecular Formula | C12H20N4O4 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 1-[2-[[1-methoxypropan-2-yl(methyl)carbamoyl]amino]ethyl]imidazole-4-carboxylic acid |
| SMILES | COCC(C)N(C)C(=O)NCCn1cnc(C(=O)O)c1 |
| InChI | InChI=1S/C12H20N4O4/c1-9(7-20-3)15(2)12(19)13-4-5-16-6-10(11(17)18)14-8-16/h6,8-9H,4-5,7H2,1-3H3,(H,13,19)(H,17,18) |
| InChIKey | JRKVLSIDNACUBV-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |