About ethyl 2-piperazin-2-ylacetate
ethyl 2-piperazin-2-ylacetate (PubChem CID 10749720) has the molecular formula C8H16N2O2
and a molecular weight of 172.23 g/mol. Its IUPAC name is ethyl 2-piperazin-2-ylacetate.
Molecular Properties
| Compound Name | ethyl 2-piperazin-2-ylacetate |
| PubChem CID | 10749720 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | ethyl 2-piperazin-2-ylacetate |
| SMILES | CCOC(=O)CC1CNCCN1 |
| InChI | InChI=1S/C8H16N2O2/c1-2-12-8(11)5-7-6-9-3-4-10-7/h7,9-10H,2-6H2,1H3 |
| InChIKey | LPCVZQJECZADQY-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-piperazin-2-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-piperazin-2-ylacetate?
The IUPAC name of ethyl 2-piperazin-2-ylacetate (CID 10749720) is ethyl 2-piperazin-2-ylacetate.
What is the SMILES notation for ethyl 2-piperazin-2-ylacetate?
The canonical SMILES for ethyl 2-piperazin-2-ylacetate is CCOC(=O)CC1CNCCN1.
What is the InChIKey of ethyl 2-piperazin-2-ylacetate?
The InChIKey is LPCVZQJECZADQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O2/c1-2-12-8(11)5-7-6-9-3-4-10-7/h7,9-10H,2-6H2,1H3.
What are the key properties of ethyl 2-piperazin-2-ylacetate?
ethyl 2-piperazin-2-ylacetate has a molecular weight of 172.23 g/mol, XLogP of -0.50, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-piperazin-2-ylacetate is sourced from PubChem (CID 10749720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).