1-[2-(hexa-2,4-dienoylamino)ethyl]imidazole-4-carboxylic acid

C12H15N3O3 — CID 107497246

IUPAC1-[2-(hexa-2,4-dienoylamino)ethyl]imidazole-4-carboxylic acid
SMILESCC=CC=CC(=O)NCCn1cnc(C(=O)O)c1
InChIInChI=1S/C12H15N3O3/c1-2-3-4-5-11(16)13-6-7-15-8-10(12(17)18)14-9-15/h2-5,8-9H,6-7H2,1H3,(H,13,16)(H,17,18)
InChIKeyYMHYQNSIJKHXKR-UHFFFAOYSA-N
MW249.27 g/mol
LogP0.83
Rot. Bonds6

About 1-[2-(hexa-2,4-dienoylamino)ethyl]imidazole-4-carboxylic acid

1-[2-(hexa-2,4-dienoylamino)ethyl]imidazole-4-carboxylic acid (PubChem CID 107497246) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is 1-[2-(hexa-2,4-dienoylamino)ethyl]imidazole-4-carboxylic acid.

Molecular Properties

Compound Name1-[2-(hexa-2,4-dienoylamino)ethyl]imidazole-4-carboxylic acid
PubChem CID107497246
Molecular FormulaC12H15N3O3
Molecular Weight249.27 g/mol
Exact Mass249.11
IUPAC Name1-[2-(hexa-2,4-dienoylamino)ethyl]imidazole-4-carboxylic acid
SMILESCC=CC=CC(=O)NCCn1cnc(C(=O)O)c1
InChIInChI=1S/C12H15N3O3/c1-2-3-4-5-11(16)13-6-7-15-8-10(12(17)18)14-9-15/h2-5,8-9H,6-7H2,1H3,(H,13,16)(H,17,18)
InChIKeyYMHYQNSIJKHXKR-UHFFFAOYSA-N
XLogP0.83
TPSA84.22 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.27
LogP ≤ 50.83
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze 1-[2-(hexa-2,4-dienoylamino)ethyl]imidazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-[2-(hexa-2,4-dienoylamino)ethyl]imidazole-4-carboxylic acid?
The IUPAC name of 1-[2-(hexa-2,4-dienoylamino)ethyl]imidazole-4-carboxylic acid (CID 107497246) is 1-[2-(hexa-2,4-dienoylamino)ethyl]imidazole-4-carboxylic acid.
What is the SMILES notation for 1-[2-(hexa-2,4-dienoylamino)ethyl]imidazole-4-carboxylic acid?
The canonical SMILES for 1-[2-(hexa-2,4-dienoylamino)ethyl]imidazole-4-carboxylic acid is CC=CC=CC(=O)NCCn1cnc(C(=O)O)c1.
What is the InChIKey of 1-[2-(hexa-2,4-dienoylamino)ethyl]imidazole-4-carboxylic acid?
The InChIKey is YMHYQNSIJKHXKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O3/c1-2-3-4-5-11(16)13-6-7-15-8-10(12(17)18)14-9-15/h2-5,8-9H,6-7H2,1H3,(H,13,16)(H,17,18).
What are the key properties of 1-[2-(hexa-2,4-dienoylamino)ethyl]imidazole-4-carboxylic acid?
1-[2-(hexa-2,4-dienoylamino)ethyl]imidazole-4-carboxylic acid has a molecular weight of 249.27 g/mol, XLogP of 0.83, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(hexa-2,4-dienoylamino)ethyl]imidazole-4-carboxylic acid is sourced from PubChem (CID 107497246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).