C13H20N4O4 — CID 107497422
1-[2-(oxan-3-ylmethylcarbamoylamino)ethyl]imidazole-4-carboxylic acid (PubChem CID 107497422) has the molecular formula C13H20N4O4 and a molecular weight of 296.33 g/mol. Its IUPAC name is 1-[2-(oxan-3-ylmethylcarbamoylamino)ethyl]imidazole-4-carboxylic acid.
| Compound Name | 1-[2-(oxan-3-ylmethylcarbamoylamino)ethyl]imidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 107497422 |
| Molecular Formula | C13H20N4O4 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 1-[2-(oxan-3-ylmethylcarbamoylamino)ethyl]imidazole-4-carboxylic acid |
| SMILES | O=C(NCCn1cnc(C(=O)O)c1)NCC1CCCOC1 |
| InChI | InChI=1S/C13H20N4O4/c18-12(19)11-7-17(9-16-11)4-3-14-13(20)15-6-10-2-1-5-21-8-10/h7,9-10H,1-6,8H2,(H,18,19)(H2,14,15,20) |
| InChIKey | MBOQUWONDCWENW-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |