C11H15F3N4O3 — CID 107497870
1-[2-(4,4,4-trifluorobutylcarbamoylamino)ethyl]imidazole-4-carboxylic acid (PubChem CID 107497870) has the molecular formula C11H15F3N4O3 and a molecular weight of 308.26 g/mol. Its IUPAC name is 1-[2-(4,4,4-trifluorobutylcarbamoylamino)ethyl]imidazole-4-carboxylic acid.
| Compound Name | 1-[2-(4,4,4-trifluorobutylcarbamoylamino)ethyl]imidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 107497870 |
| Molecular Formula | C11H15F3N4O3 |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 1-[2-(4,4,4-trifluorobutylcarbamoylamino)ethyl]imidazole-4-carboxylic acid |
| SMILES | O=C(NCCCC(F)(F)F)NCCn1cnc(C(=O)O)c1 |
| InChI | InChI=1S/C11H15F3N4O3/c12-11(13,14)2-1-3-15-10(21)16-4-5-18-6-8(9(19)20)17-7-18/h6-7H,1-5H2,(H,19,20)(H2,15,16,21) |
| InChIKey | NQUNAYYMMDKOTJ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|