C14H20N4OS — CID 107497882
1-(2-aminoethyl)-N-propan-2-yl-N-(thiophen-2-ylmethyl)imidazole-4-carboxamide (PubChem CID 107497882) has the molecular formula C14H20N4OS and a molecular weight of 292.41 g/mol. Its IUPAC name is 1-(2-aminoethyl)-N-propan-2-yl-N-(thiophen-2-ylmethyl)imidazole-4-carboxamide.
| Compound Name | 1-(2-aminoethyl)-N-propan-2-yl-N-(thiophen-2-ylmethyl)imidazole-4-carboxamide |
|---|---|
| PubChem CID | 107497882 |
| Molecular Formula | C14H20N4OS |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 1-(2-aminoethyl)-N-propan-2-yl-N-(thiophen-2-ylmethyl)imidazole-4-carboxamide |
| SMILES | CC(C)N(Cc1cccs1)C(=O)c1cn(CCN)cn1 |
| InChI | InChI=1S/C14H20N4OS/c1-11(2)18(8-12-4-3-7-20-12)14(19)13-9-17(6-5-15)10-16-13/h3-4,7,9-11H,5-6,8,15H2,1-2H3 |
| InChIKey | ZUJRLRBDWOZSNU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |