C14H20Cl2N2O2 — CID 107497904
2-(2-amino-4,5-dichlorophenoxy)-N-(2-methylbutan-2-yl)propanamide (PubChem CID 107497904) has the molecular formula C14H20Cl2N2O2 and a molecular weight of 319.23 g/mol. Its IUPAC name is 2-(2-amino-4,5-dichlorophenoxy)-N-(2-methylbutan-2-yl)propanamide.
| Compound Name | 2-(2-amino-4,5-dichlorophenoxy)-N-(2-methylbutan-2-yl)propanamide |
|---|---|
| PubChem CID | 107497904 |
| Molecular Formula | C14H20Cl2N2O2 |
| Molecular Weight | 319.23 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 2-(2-amino-4,5-dichlorophenoxy)-N-(2-methylbutan-2-yl)propanamide |
| SMILES | CCC(C)(C)NC(=O)C(C)Oc1cc(Cl)c(Cl)cc1N |
| InChI | InChI=1S/C14H20Cl2N2O2/c1-5-14(3,4)18-13(19)8(2)20-12-7-10(16)9(15)6-11(12)17/h6-8H,5,17H2,1-4H3,(H,18,19) |
| InChIKey | FFGNEEODWBMGMD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.23 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|