C12H21N5O2 — CID 107498083
1-(2-aminoethyl)-N-[3-oxo-3-(propylamino)propyl]imidazole-4-carboxamide (PubChem CID 107498083) has the molecular formula C12H21N5O2 and a molecular weight of 267.33 g/mol. Its IUPAC name is 1-(2-aminoethyl)-N-[3-oxo-3-(propylamino)propyl]imidazole-4-carboxamide.
| Compound Name | 1-(2-aminoethyl)-N-[3-oxo-3-(propylamino)propyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 107498083 |
| Molecular Formula | C12H21N5O2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 1-(2-aminoethyl)-N-[3-oxo-3-(propylamino)propyl]imidazole-4-carboxamide |
| SMILES | CCCNC(=O)CCNC(=O)c1cn(CCN)cn1 |
| InChI | InChI=1S/C12H21N5O2/c1-2-5-14-11(18)3-6-15-12(19)10-8-17(7-4-13)9-16-10/h8-9H,2-7,13H2,1H3,(H,14,18)(H,15,19) |
| InChIKey | FWWNNRPKFVDCMR-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |