C13H22N4O4 — CID 107498437
1-[2-[(2-ethoxy-2-methylpropyl)carbamoylamino]ethyl]imidazole-4-carboxylic acid (PubChem CID 107498437) has the molecular formula C13H22N4O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is 1-[2-[(2-ethoxy-2-methylpropyl)carbamoylamino]ethyl]imidazole-4-carboxylic acid.
| Compound Name | 1-[2-[(2-ethoxy-2-methylpropyl)carbamoylamino]ethyl]imidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 107498437 |
| Molecular Formula | C13H22N4O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 1-[2-[(2-ethoxy-2-methylpropyl)carbamoylamino]ethyl]imidazole-4-carboxylic acid |
| SMILES | CCOC(C)(C)CNC(=O)NCCn1cnc(C(=O)O)c1 |
| InChI | InChI=1S/C13H22N4O4/c1-4-21-13(2,3)8-15-12(20)14-5-6-17-7-10(11(18)19)16-9-17/h7,9H,4-6,8H2,1-3H3,(H,18,19)(H2,14,15,20) |
| InChIKey | CWCRSLLFJILQPP-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |