C14H9Cl2FN2O — CID 107498575
3-[(2-amino-4,5-dichlorophenoxy)methyl]-4-fluorobenzonitrile (PubChem CID 107498575) has the molecular formula C14H9Cl2FN2O and a molecular weight of 311.14 g/mol. Its IUPAC name is 3-[(2-amino-4,5-dichlorophenoxy)methyl]-4-fluorobenzonitrile.
| Compound Name | 3-[(2-amino-4,5-dichlorophenoxy)methyl]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 107498575 |
| Molecular Formula | C14H9Cl2FN2O |
| Molecular Weight | 311.14 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 3-[(2-amino-4,5-dichlorophenoxy)methyl]-4-fluorobenzonitrile |
| SMILES | N#Cc1ccc(F)c(COc2cc(Cl)c(Cl)cc2N)c1 |
| InChI | InChI=1S/C14H9Cl2FN2O/c15-10-4-13(19)14(5-11(10)16)20-7-9-3-8(6-18)1-2-12(9)17/h1-5H,7,19H2 |
| InChIKey | HMAAFMMGLJRJJL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.14 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|