C11H8Cl3NOS — CID 107498892
4,5-dichloro-2-[(5-chlorothiophen-2-yl)methoxy]aniline (PubChem CID 107498892) has the molecular formula C11H8Cl3NOS and a molecular weight of 308.62 g/mol. Its IUPAC name is 4,5-dichloro-2-[(5-chlorothiophen-2-yl)methoxy]aniline.
| Compound Name | 4,5-dichloro-2-[(5-chlorothiophen-2-yl)methoxy]aniline |
|---|---|
| PubChem CID | 107498892 |
| Molecular Formula | C11H8Cl3NOS |
| Molecular Weight | 308.62 g/mol |
| Exact Mass | 306.94 |
| IUPAC Name | 4,5-dichloro-2-[(5-chlorothiophen-2-yl)methoxy]aniline |
| SMILES | Nc1cc(Cl)c(Cl)cc1OCc1ccc(Cl)s1 |
| InChI | InChI=1S/C11H8Cl3NOS/c12-7-3-9(15)10(4-8(7)13)16-5-6-1-2-11(14)17-6/h1-4H,5,15H2 |
| InChIKey | SEXVARILHFPUGB-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.62 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|