About (1R,5S)-1,5-dimethyl-7-methylidenebicyclo[3.3.1]nonan-3-ol
(1R,5S)-1,5-dimethyl-7-methylidenebicyclo[3.3.1]nonan-3-ol (PubChem CID 10749891) has the molecular formula C12H20O
and a molecular weight of 180.29 g/mol. Its IUPAC name is (1R,5S)-1,5-dimethyl-7-methylidenebicyclo[3.3.1]nonan-3-ol.
Molecular Properties
| Compound Name | (1R,5S)-1,5-dimethyl-7-methylidenebicyclo[3.3.1]nonan-3-ol |
| PubChem CID | 10749891 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (1R,5S)-1,5-dimethyl-7-methylidenebicyclo[3.3.1]nonan-3-ol |
| SMILES | C=C1C[C@@]2(C)CC(O)C[C@@](C)(C1)C2 |
| InChI | InChI=1S/C12H20O/c1-9-4-11(2)6-10(13)7-12(3,5-9)8-11/h10,13H,1,4-8H2,2-3H3/t10?,11-,12+ |
| InChIKey | RNKMVNKGLUABJS-YOGCLGLASA-N |
| XLogP | 2.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1R,5S)-1,5-dimethyl-7-methylidenebicyclo[3.3.1]nonan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,5S)-1,5-dimethyl-7-methylidenebicyclo[3.3.1]nonan-3-ol?
The IUPAC name of (1R,5S)-1,5-dimethyl-7-methylidenebicyclo[3.3.1]nonan-3-ol (CID 10749891) is (1R,5S)-1,5-dimethyl-7-methylidenebicyclo[3.3.1]nonan-3-ol.
What is the SMILES notation for (1R,5S)-1,5-dimethyl-7-methylidenebicyclo[3.3.1]nonan-3-ol?
The canonical SMILES for (1R,5S)-1,5-dimethyl-7-methylidenebicyclo[3.3.1]nonan-3-ol is C=C1C[C@@]2(C)CC(O)C[C@@](C)(C1)C2.
What is the InChIKey of (1R,5S)-1,5-dimethyl-7-methylidenebicyclo[3.3.1]nonan-3-ol?
The InChIKey is RNKMVNKGLUABJS-YOGCLGLASA-N. The full InChI is InChI=1S/C12H20O/c1-9-4-11(2)6-10(13)7-12(3,5-9)8-11/h10,13H,1,4-8H2,2-3H3/t10?,11-,12+.
What are the key properties of (1R,5S)-1,5-dimethyl-7-methylidenebicyclo[3.3.1]nonan-3-ol?
(1R,5S)-1,5-dimethyl-7-methylidenebicyclo[3.3.1]nonan-3-ol has a molecular weight of 180.29 g/mol, XLogP of 2.89, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,5S)-1,5-dimethyl-7-methylidenebicyclo[3.3.1]nonan-3-ol is sourced from PubChem (CID 10749891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).