C12H20N4O3 — CID 107499354
[1-(2-aminoethyl)imidazol-4-yl]-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]methanone (PubChem CID 107499354) has the molecular formula C12H20N4O3 and a molecular weight of 268.32 g/mol. Its IUPAC name is [1-(2-aminoethyl)imidazol-4-yl]-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]methanone.
| Compound Name | [1-(2-aminoethyl)imidazol-4-yl]-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 107499354 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | [1-(2-aminoethyl)imidazol-4-yl]-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]methanone |
| SMILES | CC1COC(CO)CN1C(=O)c1cn(CCN)cn1 |
| InChI | InChI=1S/C12H20N4O3/c1-9-7-19-10(6-17)4-16(9)12(18)11-5-15(3-2-13)8-14-11/h5,8-10,17H,2-4,6-7,13H2,1H3 |
| InChIKey | URAZITJJVWHXAN-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |