About (4R)-4-[(2S,4R)-4-hydroxypyrrolidin-2-yl]piperidin-2-one
(4R)-4-[(2S,4R)-4-hydroxypyrrolidin-2-yl]piperidin-2-one (PubChem CID 10749987) has the molecular formula C9H16N2O2
and a molecular weight of 184.24 g/mol. Its IUPAC name is (4R)-4-[(2S,4R)-4-hydroxypyrrolidin-2-yl]piperidin-2-one.
Molecular Properties
| Compound Name | (4R)-4-[(2S,4R)-4-hydroxypyrrolidin-2-yl]piperidin-2-one |
| PubChem CID | 10749987 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | (4R)-4-[(2S,4R)-4-hydroxypyrrolidin-2-yl]piperidin-2-one |
| SMILES | O=C1C[C@H]([C@@H]2C[C@@H](O)CN2)CCN1 |
| InChI | InChI=1S/C9H16N2O2/c12-7-4-8(11-5-7)6-1-2-10-9(13)3-6/h6-8,11-12H,1-5H2,(H,10,13)/t6-,7-,8+/m1/s1 |
| InChIKey | NXEHNTQMFGAWOU-PRJMDXOYSA-N |
| XLogP | -0.76 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-4-[(2S,4R)-4-hydroxypyrrolidin-2-yl]piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-[(2S,4R)-4-hydroxypyrrolidin-2-yl]piperidin-2-one?
The IUPAC name of (4R)-4-[(2S,4R)-4-hydroxypyrrolidin-2-yl]piperidin-2-one (CID 10749987) is (4R)-4-[(2S,4R)-4-hydroxypyrrolidin-2-yl]piperidin-2-one.
What is the SMILES notation for (4R)-4-[(2S,4R)-4-hydroxypyrrolidin-2-yl]piperidin-2-one?
The canonical SMILES for (4R)-4-[(2S,4R)-4-hydroxypyrrolidin-2-yl]piperidin-2-one is O=C1C[C@H]([C@@H]2C[C@@H](O)CN2)CCN1.
What is the InChIKey of (4R)-4-[(2S,4R)-4-hydroxypyrrolidin-2-yl]piperidin-2-one?
The InChIKey is NXEHNTQMFGAWOU-PRJMDXOYSA-N. The full InChI is InChI=1S/C9H16N2O2/c12-7-4-8(11-5-7)6-1-2-10-9(13)3-6/h6-8,11-12H,1-5H2,(H,10,13)/t6-,7-,8+/m1/s1.
What are the key properties of (4R)-4-[(2S,4R)-4-hydroxypyrrolidin-2-yl]piperidin-2-one?
(4R)-4-[(2S,4R)-4-hydroxypyrrolidin-2-yl]piperidin-2-one has a molecular weight of 184.24 g/mol, XLogP of -0.76, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-[(2S,4R)-4-hydroxypyrrolidin-2-yl]piperidin-2-one is sourced from PubChem (CID 10749987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).